C25H36O6 — CID 134982638
dimethyl (7Z)-8-butyl-7-(1-methoxy-1-oxohexan-2-ylidene)-1,3,5,6-tetrahydronaphthalene-2,2-dicarboxylate (PubChem CID 134982638) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is dimethyl (7Z)-8-butyl-7-(1-methoxy-1-oxohexan-2-ylidene)-1,3,5,6-tetrahydronaphthalene-2,2-dicarboxylate.
| Compound Name | dimethyl (7Z)-8-butyl-7-(1-methoxy-1-oxohexan-2-ylidene)-1,3,5,6-tetrahydronaphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 134982638 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | dimethyl (7Z)-8-butyl-7-(1-methoxy-1-oxohexan-2-ylidene)-1,3,5,6-tetrahydronaphthalene-2,2-dicarboxylate |
| SMILES | CCCCC1=C2CC(C(=O)OC)(C(=O)OC)CC=C2CC/C1=C(\CCCC)C(=O)OC |
| InChI | InChI=1S/C25H36O6/c1-6-8-10-18-19(20(11-9-7-2)22(26)29-3)13-12-17-14-15-25(16-21(17)18,23(27)30-4)24(28)31-5/h14H,6-13,15-16H2,1-5H3/b20-19- |
| InChIKey | LIQLLZHNMYUJEA-VXPUYCOJSA-N |
| XLogP | 4.98 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|