C18H16N2O2 — CID 134982824
(2E)-2-(4-nitrophenyl)-2-(4-propan-2-ylcyclohepta-2,4,6-trien-1-ylidene)acetonitrile (PubChem CID 134982824) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is (2E)-2-(4-nitrophenyl)-2-(4-propan-2-ylcyclohepta-2,4,6-trien-1-ylidene)acetonitrile.
| Compound Name | (2E)-2-(4-nitrophenyl)-2-(4-propan-2-ylcyclohepta-2,4,6-trien-1-ylidene)acetonitrile |
|---|---|
| PubChem CID | 134982824 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (2E)-2-(4-nitrophenyl)-2-(4-propan-2-ylcyclohepta-2,4,6-trien-1-ylidene)acetonitrile |
| SMILES | CC(C)C1=CC=C/C(=C(\C#N)c2ccc([N+](=O)[O-])cc2)C=C1 |
| InChI | InChI=1S/C18H16N2O2/c1-13(2)14-4-3-5-15(7-6-14)18(12-19)16-8-10-17(11-9-16)20(21)22/h3-11,13H,1-2H3/b18-15- |
| InChIKey | QYUMOBVZVVOBJQ-SDXDJHTJSA-N |
| XLogP | 4.58 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|