C12H20O4 — CID 134983145
[(Z)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate (PubChem CID 134983145) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is [(Z)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate.
| Compound Name | [(Z)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate |
|---|---|
| PubChem CID | 134983145 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | [(Z)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate |
| SMILES | CC(=O)OCCCC/C=C\C1(C)OCCO1 |
| InChI | InChI=1S/C12H20O4/c1-11(13)14-8-6-4-3-5-7-12(2)15-9-10-16-12/h5,7H,3-4,6,8-10H2,1-2H3/b7-5- |
| InChIKey | WFUMFQJYUDHWQG-ALCCZGGFSA-N |
| XLogP | 2.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|