C14H23BrO6 — CID 10948566
[(Z,1S,2R)-5-bromo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(methoxymethoxy)pent-3-en-2-yl] acetate (PubChem CID 10948566) has the molecular formula C14H23BrO6 and a molecular weight of 367.24 g/mol. Its IUPAC name is [(Z,1S,2R)-5-bromo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(methoxymethoxy)pent-3-en-2-yl] acetate.
| Compound Name | [(Z,1S,2R)-5-bromo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(methoxymethoxy)pent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 10948566 |
| Molecular Formula | C14H23BrO6 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [(Z,1S,2R)-5-bromo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(methoxymethoxy)pent-3-en-2-yl] acetate |
| SMILES | COCO[C@@H]([C@@H](/C=C\CBr)OC(C)=O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C14H23BrO6/c1-10(16)20-11(6-5-7-15)13(18-9-17-4)12-8-19-14(2,3)21-12/h5-6,11-13H,7-9H2,1-4H3/b6-5-/t11-,12-,13+/m1/s1 |
| InChIKey | UQVAJJQMICSWEA-RCAPSXEPSA-N |
| XLogP | 2.01 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|