C12H19BrO4 — CID 86240069
2-(4-bromo-1,1-diethoxybutyl)-2H-furan-5-one (PubChem CID 86240069) has the molecular formula C12H19BrO4 and a molecular weight of 307.18 g/mol. Its IUPAC name is 2-(4-bromo-1,1-diethoxybutyl)-2H-furan-5-one.
| Compound Name | 2-(4-bromo-1,1-diethoxybutyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 86240069 |
| Molecular Formula | C12H19BrO4 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-(4-bromo-1,1-diethoxybutyl)-2H-furan-5-one |
| SMILES | CCOC(CCCBr)(OCC)C1C=CC(=O)O1 |
| InChI | InChI=1S/C12H19BrO4/c1-3-15-12(16-4-2,8-5-9-13)10-6-7-11(14)17-10/h6-7,10H,3-5,8-9H2,1-2H3 |
| InChIKey | TVKHEBCQQZYNTN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|