C10H17BrO4 — CID 16724575
ethyl (E,5S)-6-bromo-5-(methoxymethoxy)hex-2-enoate (PubChem CID 16724575) has the molecular formula C10H17BrO4 and a molecular weight of 281.15 g/mol. Its IUPAC name is ethyl (E,5S)-6-bromo-5-(methoxymethoxy)hex-2-enoate.
| Compound Name | ethyl (E,5S)-6-bromo-5-(methoxymethoxy)hex-2-enoate |
|---|---|
| PubChem CID | 16724575 |
| Molecular Formula | C10H17BrO4 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | ethyl (E,5S)-6-bromo-5-(methoxymethoxy)hex-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](CBr)OCOC |
| InChI | InChI=1S/C10H17BrO4/c1-3-14-10(12)6-4-5-9(7-11)15-8-13-2/h4,6,9H,3,5,7-8H2,1-2H3/b6-4+/t9-/m0/s1 |
| InChIKey | SJMJGLVAMQOXIF-DNQSNQRASA-N |
| XLogP | 1.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|