C11H17BrO4 — CID 134890030
ethyl (E)-4-[2-(bromomethyl)-1,3-dioxan-2-yl]but-2-enoate (PubChem CID 134890030) has the molecular formula C11H17BrO4 and a molecular weight of 293.16 g/mol. Its IUPAC name is ethyl (E)-4-[2-(bromomethyl)-1,3-dioxan-2-yl]but-2-enoate.
| Compound Name | ethyl (E)-4-[2-(bromomethyl)-1,3-dioxan-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 134890030 |
| Molecular Formula | C11H17BrO4 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | ethyl (E)-4-[2-(bromomethyl)-1,3-dioxan-2-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CC1(CBr)OCCCO1 |
| InChI | InChI=1S/C11H17BrO4/c1-2-14-10(13)5-3-6-11(9-12)15-7-4-8-16-11/h3,5H,2,4,6-9H2,1H3/b5-3+ |
| InChIKey | OETSAPNDUJYVOL-HWKANZROSA-N |
| XLogP | 2.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|