C10H15BrO4 — CID 10967874
methyl (E)-4-[2-(bromomethyl)-1,3-dioxan-2-yl]but-2-enoate (PubChem CID 10967874) has the molecular formula C10H15BrO4 and a molecular weight of 279.13 g/mol. Its IUPAC name is methyl (E)-4-[2-(bromomethyl)-1,3-dioxan-2-yl]but-2-enoate.
| Compound Name | methyl (E)-4-[2-(bromomethyl)-1,3-dioxan-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 10967874 |
| Molecular Formula | C10H15BrO4 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | methyl (E)-4-[2-(bromomethyl)-1,3-dioxan-2-yl]but-2-enoate |
| SMILES | COC(=O)/C=C/CC1(CBr)OCCCO1 |
| InChI | InChI=1S/C10H15BrO4/c1-13-9(12)4-2-5-10(8-11)14-6-3-7-15-10/h2,4H,3,5-8H2,1H3/b4-2+ |
| InChIKey | LQIARMBMCZYDCZ-DUXPYHPUSA-N |
| XLogP | 1.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|