C18H22Br2O4 — CID 72711461
[(1E,3S,5E,8S,9E)-1,10-dibromo-8-[(E)-but-2-enoyl]oxydeca-1,5,9-trien-3-yl] (E)-but-2-enoate (PubChem CID 72711461) has the molecular formula C18H22Br2O4 and a molecular weight of 462.18 g/mol. Its IUPAC name is [(1E,3S,5E,8S,9E)-1,10-dibromo-8-[(E)-but-2-enoyl]oxydeca-1,5,9-trien-3-yl] (E)-but-2-enoate.
| Compound Name | [(1E,3S,5E,8S,9E)-1,10-dibromo-8-[(E)-but-2-enoyl]oxydeca-1,5,9-trien-3-yl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 72711461 |
| Molecular Formula | C18H22Br2O4 |
| Molecular Weight | 462.18 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | [(1E,3S,5E,8S,9E)-1,10-dibromo-8-[(E)-but-2-enoyl]oxydeca-1,5,9-trien-3-yl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)O[C@H](/C=C/Br)C/C=C/C[C@@H](/C=C/Br)OC(=O)/C=C/C |
| InChI | InChI=1S/C18H22Br2O4/c1-3-7-17(21)23-15(11-13-19)9-5-6-10-16(12-14-20)24-18(22)8-4-2/h3-8,11-16H,9-10H2,1-2H3/b6-5+,7-3+,8-4+,13-11+,14-12+/t15-,16-/m0/s1 |
| InChIKey | UZUXAYKTGBYQMX-LOGCSXAWSA-N |
| XLogP | 5.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.18 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|