C15H24O6 — CID 135015556
(3-acetyloxy-6-pentoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate (PubChem CID 135015556) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is (3-acetyloxy-6-pentoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate.
| Compound Name | (3-acetyloxy-6-pentoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate |
|---|---|
| PubChem CID | 135015556 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (3-acetyloxy-6-pentoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate |
| SMILES | CCCCCOC1C=CC(OC(C)=O)C(COC(C)=O)O1 |
| InChI | InChI=1S/C15H24O6/c1-4-5-6-9-18-15-8-7-13(20-12(3)17)14(21-15)10-19-11(2)16/h7-8,13-15H,4-6,9-10H2,1-3H3 |
| InChIKey | JDHKPSSMAPAHKD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|