C12H20O4 — CID 134986149
[(2S,4R,5S)-2-methyl-5-[(Z)-pent-1-enyl]-1,3-dioxolan-4-yl]methyl acetate (PubChem CID 134986149) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is [(2S,4R,5S)-2-methyl-5-[(Z)-pent-1-enyl]-1,3-dioxolan-4-yl]methyl acetate.
| Compound Name | [(2S,4R,5S)-2-methyl-5-[(Z)-pent-1-enyl]-1,3-dioxolan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 134986149 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | [(2S,4R,5S)-2-methyl-5-[(Z)-pent-1-enyl]-1,3-dioxolan-4-yl]methyl acetate |
| SMILES | CCC/C=C\[C@@H]1O[C@H](C)O[C@@H]1COC(C)=O |
| InChI | InChI=1S/C12H20O4/c1-4-5-6-7-11-12(8-14-9(2)13)16-10(3)15-11/h6-7,10-12H,4-5,8H2,1-3H3/b7-6-/t10-,11-,12+/m0/s1 |
| InChIKey | FPEJVHCFHHLSHM-IWCARMMRSA-N |
| XLogP | 2.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|