C10H12N2 — CID 134983973
methyl-[(1R,2R)-2-phenylcyclopropyl]diazene (PubChem CID 134983973) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is methyl-[(1R,2R)-2-phenylcyclopropyl]diazene.
| Compound Name | methyl-[(1R,2R)-2-phenylcyclopropyl]diazene |
|---|---|
| PubChem CID | 134983973 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | methyl-[(1R,2R)-2-phenylcyclopropyl]diazene |
| SMILES | C/N=N/[C@@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C10H12N2/c1-11-12-10-7-9(10)8-5-3-2-4-6-8/h2-6,9-10H,7H2,1H3/b12-11+/t9-,10-/m1/s1 |
| InChIKey | WAOPHZOHVOQFHJ-PMBNAOTOSA-N |
| XLogP | 2.62 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|