About methyl-[(1R,2R)-2-phenylcyclopropyl]diazene
methyl-[(1R,2R)-2-phenylcyclopropyl]diazene (PubChem CID 134983973) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is methyl-[(1R,2R)-2-phenylcyclopropyl]diazene.
Molecular Properties
| Compound Name | methyl-[(1R,2R)-2-phenylcyclopropyl]diazene |
| PubChem CID | 134983973 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | methyl-[(1R,2R)-2-phenylcyclopropyl]diazene |
| SMILES | C/N=N/[C@@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C10H12N2/c1-11-12-10-7-9(10)8-5-3-2-4-6-8/h2-6,9-10H,7H2,1H3/b12-11+/t9-,10-/m1/s1 |
| InChIKey | WAOPHZOHVOQFHJ-PMBNAOTOSA-N |
| XLogP | 2.62 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl-[(1R,2R)-2-phenylcyclopropyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[(1R,2R)-2-phenylcyclopropyl]diazene?
The IUPAC name of methyl-[(1R,2R)-2-phenylcyclopropyl]diazene (CID 134983973) is methyl-[(1R,2R)-2-phenylcyclopropyl]diazene.
What is the SMILES notation for methyl-[(1R,2R)-2-phenylcyclopropyl]diazene?
The canonical SMILES for methyl-[(1R,2R)-2-phenylcyclopropyl]diazene is C/N=N/[C@@H]1C[C@@H]1c1ccccc1.
What is the InChIKey of methyl-[(1R,2R)-2-phenylcyclopropyl]diazene?
The InChIKey is WAOPHZOHVOQFHJ-PMBNAOTOSA-N. The full InChI is InChI=1S/C10H12N2/c1-11-12-10-7-9(10)8-5-3-2-4-6-8/h2-6,9-10H,7H2,1H3/b12-11+/t9-,10-/m1/s1.
What are the key properties of methyl-[(1R,2R)-2-phenylcyclopropyl]diazene?
methyl-[(1R,2R)-2-phenylcyclopropyl]diazene has a molecular weight of 160.22 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[(1R,2R)-2-phenylcyclopropyl]diazene is sourced from PubChem (CID 134983973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).