C19H23NOSe — CID 134984308
(3S,4S)-2-butan-2-yl-3-phenyl-4-phenylselanyl-1,2-oxazolidine (PubChem CID 134984308) has the molecular formula C19H23NOSe and a molecular weight of 360.36 g/mol. Its IUPAC name is (3S,4S)-2-butan-2-yl-3-phenyl-4-phenylselanyl-1,2-oxazolidine.
| Compound Name | (3S,4S)-2-butan-2-yl-3-phenyl-4-phenylselanyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 134984308 |
| Molecular Formula | C19H23NOSe |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (3S,4S)-2-butan-2-yl-3-phenyl-4-phenylselanyl-1,2-oxazolidine |
| SMILES | CCC(C)N1OC[C@@H]([Se]c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H23NOSe/c1-3-15(2)20-19(16-10-6-4-7-11-16)18(14-21-20)22-17-12-8-5-9-13-17/h4-13,15,18-19H,3,14H2,1-2H3/t15?,18-,19+/m1/s1 |
| InChIKey | QKSNNEPSVCRUPP-FWZRCDJUSA-N |
| XLogP | 3.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|