C19H22ClNO2 — CID 134985454
N-tert-butyl-N-[(S)-(4-chlorophenyl)-[(2R)-2-phenyloxiran-2-yl]methyl]hydroxylamine (PubChem CID 134985454) has the molecular formula C19H22ClNO2 and a molecular weight of 331.84 g/mol. Its IUPAC name is N-tert-butyl-N-[(S)-(4-chlorophenyl)-[(2R)-2-phenyloxiran-2-yl]methyl]hydroxylamine.
| Compound Name | N-tert-butyl-N-[(S)-(4-chlorophenyl)-[(2R)-2-phenyloxiran-2-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 134985454 |
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-tert-butyl-N-[(S)-(4-chlorophenyl)-[(2R)-2-phenyloxiran-2-yl]methyl]hydroxylamine |
| SMILES | CC(C)(C)N(O)[C@@H](c1ccc(Cl)cc1)[C@]1(c2ccccc2)CO1 |
| InChI | InChI=1S/C19H22ClNO2/c1-18(2,3)21(22)17(14-9-11-16(20)12-10-14)19(13-23-19)15-7-5-4-6-8-15/h4-12,17,22H,13H2,1-3H3/t17-,19+/m0/s1 |
| InChIKey | NLZIBFWEBSZKEI-PKOBYXMFSA-N |
| XLogP | 4.80 |
| TPSA | 36.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|