C30H28ClNO2 — CID 101407223
N-[(R)-(4-chlorophenyl)-[(2S,3S)-2,3-diphenyloxiran-2-yl]methyl]-N-(2-phenylpropan-2-yl)hydroxylamine (PubChem CID 101407223) has the molecular formula C30H28ClNO2 and a molecular weight of 470.01 g/mol. Its IUPAC name is N-[(R)-(4-chlorophenyl)-[(2S,3S)-2,3-diphenyloxiran-2-yl]methyl]-N-(2-phenylpropan-2-yl)hydroxylamine.
| Compound Name | N-[(R)-(4-chlorophenyl)-[(2S,3S)-2,3-diphenyloxiran-2-yl]methyl]-N-(2-phenylpropan-2-yl)hydroxylamine |
|---|---|
| PubChem CID | 101407223 |
| Molecular Formula | C30H28ClNO2 |
| Molecular Weight | 470.01 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-[(R)-(4-chlorophenyl)-[(2S,3S)-2,3-diphenyloxiran-2-yl]methyl]-N-(2-phenylpropan-2-yl)hydroxylamine |
| SMILES | CC(C)(c1ccccc1)N(O)[C@H](c1ccc(Cl)cc1)[C@]1(c2ccccc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C30H28ClNO2/c1-29(2,24-14-8-4-9-15-24)32(33)27(22-18-20-26(31)21-19-22)30(25-16-10-5-11-17-25)28(34-30)23-12-6-3-7-13-23/h3-21,27-28,33H,1-2H3/t27-,28+,30+/m1/s1 |
| InChIKey | VWYNBWRWKPLDQG-UNRZKBSHSA-N |
| XLogP | 7.67 |
| TPSA | 36.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.01 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|