C24H30N2O5 — CID 134985636
diethyl (4S,9R)-9-(4-methoxyphenyl)-5,5,6-trimethyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate (PubChem CID 134985636) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is diethyl (4S,9R)-9-(4-methoxyphenyl)-5,5,6-trimethyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate.
| Compound Name | diethyl (4S,9R)-9-(4-methoxyphenyl)-5,5,6-trimethyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 134985636 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | diethyl (4S,9R)-9-(4-methoxyphenyl)-5,5,6-trimethyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)N2[C@@H](c3ccc(OC)cc3)CC3=C(C)C(C)(C)[C@@H]1N32 |
| InChI | InChI=1S/C24H30N2O5/c1-7-30-22(27)19-20(23(28)31-8-2)25-18(15-9-11-16(29-6)12-10-15)13-17-14(3)24(4,5)21(19)26(17)25/h9-12,18,21H,7-8,13H2,1-6H3/t18-,21-/m1/s1 |
| InChIKey | UHBWZQLORLMEKI-WIYYLYMNSA-N |
| XLogP | 3.74 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |