C22H25F3N2O3 — CID 102207248
ethyl (4S,9S)-9-(4-methoxyphenyl)-5,5,6-trimethyl-2-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate (PubChem CID 102207248) has the molecular formula C22H25F3N2O3 and a molecular weight of 422.45 g/mol. Its IUPAC name is ethyl (4S,9S)-9-(4-methoxyphenyl)-5,5,6-trimethyl-2-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate.
| Compound Name | ethyl (4S,9S)-9-(4-methoxyphenyl)-5,5,6-trimethyl-2-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate |
|---|---|
| PubChem CID | 102207248 |
| Molecular Formula | C22H25F3N2O3 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | ethyl (4S,9S)-9-(4-methoxyphenyl)-5,5,6-trimethyl-2-(trifluoromethyl)-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C(F)(F)F)N2[C@H](c3ccc(OC)cc3)CC3=C(C)C(C)(C)[C@@H]1N32 |
| InChI | InChI=1S/C22H25F3N2O3/c1-6-30-20(28)17-18-21(3,4)12(2)15-11-16(13-7-9-14(29-5)10-8-13)27(26(15)18)19(17)22(23,24)25/h7-10,16,18H,6,11H2,1-5H3/t16-,18+/m0/s1 |
| InChIKey | FAZRWDJMIPGBOH-FUHWJXTLSA-N |
| XLogP | 4.73 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |