C22H26N2O5 — CID 135000670
dimethyl 9-(4-methoxyphenyl)-5,5,6-trimethyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate (PubChem CID 135000670) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is dimethyl 9-(4-methoxyphenyl)-5,5,6-trimethyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate.
| Compound Name | dimethyl 9-(4-methoxyphenyl)-5,5,6-trimethyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 135000670 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | dimethyl 9-(4-methoxyphenyl)-5,5,6-trimethyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2C(c3ccc(OC)cc3)CC3=C(C)C(C)(C)C1N32 |
| InChI | InChI=1S/C22H26N2O5/c1-12-15-11-16(13-7-9-14(27-4)10-8-13)23-18(21(26)29-6)17(20(25)28-5)19(24(15)23)22(12,2)3/h7-10,16,19H,11H2,1-6H3 |
| InChIKey | QZITXNVRDSEJLG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |