C14H22S2 — CID 134985998
(6aR,10aS)-6a-methyl-2,3,4,7,8,9,10,10a,11,11a-decahydrobenzo[h][1,5]benzodithiepine (PubChem CID 134985998) has the molecular formula C14H22S2 and a molecular weight of 254.46 g/mol. Its IUPAC name is (6aR,10aS)-6a-methyl-2,3,4,7,8,9,10,10a,11,11a-decahydrobenzo[h][1,5]benzodithiepine.
| Compound Name | (6aR,10aS)-6a-methyl-2,3,4,7,8,9,10,10a,11,11a-decahydrobenzo[h][1,5]benzodithiepine |
|---|---|
| PubChem CID | 134985998 |
| Molecular Formula | C14H22S2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (6aR,10aS)-6a-methyl-2,3,4,7,8,9,10,10a,11,11a-decahydrobenzo[h][1,5]benzodithiepine |
| SMILES | C[C@]12C=C3SCCCSC3C[C@@H]1CCCC2 |
| InChI | InChI=1S/C14H22S2/c1-14-6-3-2-5-11(14)9-12-13(10-14)16-8-4-7-15-12/h10-12H,2-9H2,1H3/t11-,12?,14-/m0/s1 |
| InChIKey | ADGAVUGFKILBNG-PSIKVXPXSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |