C13H20S2 — CID 53254973
(4aR,8aR)-8a-methylspiro[1,2,3,4a,5,6-hexahydronaphthalene-4,2'-1,3-dithiolane] (PubChem CID 53254973) has the molecular formula C13H20S2 and a molecular weight of 240.44 g/mol. Its IUPAC name is (4aR,8aR)-8a-methylspiro[1,2,3,4a,5,6-hexahydronaphthalene-4,2'-1,3-dithiolane].
| Compound Name | (4aR,8aR)-8a-methylspiro[1,2,3,4a,5,6-hexahydronaphthalene-4,2'-1,3-dithiolane] |
|---|---|
| PubChem CID | 53254973 |
| Molecular Formula | C13H20S2 |
| Molecular Weight | 240.44 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (4aR,8aR)-8a-methylspiro[1,2,3,4a,5,6-hexahydronaphthalene-4,2'-1,3-dithiolane] |
| SMILES | C[C@@]12C=CCC[C@H]1C1(CCC2)SCCS1 |
| InChI | InChI=1S/C13H20S2/c1-12-6-3-2-5-11(12)13(8-4-7-12)14-9-10-15-13/h3,6,11H,2,4-5,7-10H2,1H3/t11-,12+/m1/s1 |
| InChIKey | LNZLNJINMCXKSS-NEPJUHHUSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|