C14H22S2 — CID 46217590
(4S,4aR)-4,4a-dimethylspiro[1,2,3,4,5,6-hexahydronaphthalene-7,2'-1,3-dithiolane] (PubChem CID 46217590) has the molecular formula C14H22S2 and a molecular weight of 254.46 g/mol. Its IUPAC name is (4S,4aR)-4,4a-dimethylspiro[1,2,3,4,5,6-hexahydronaphthalene-7,2'-1,3-dithiolane].
| Compound Name | (4S,4aR)-4,4a-dimethylspiro[1,2,3,4,5,6-hexahydronaphthalene-7,2'-1,3-dithiolane] |
|---|---|
| PubChem CID | 46217590 |
| Molecular Formula | C14H22S2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (4S,4aR)-4,4a-dimethylspiro[1,2,3,4,5,6-hexahydronaphthalene-7,2'-1,3-dithiolane] |
| SMILES | C[C@H]1CCCC2=CC3(CC[C@@]21C)SCCS3 |
| InChI | InChI=1S/C14H22S2/c1-11-4-3-5-12-10-14(15-8-9-16-14)7-6-13(11,12)2/h10-11H,3-9H2,1-2H3/t11-,13+/m0/s1 |
| InChIKey | ZARSXRMVMQFCGS-WCQYABFASA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|