C19H30S2 — CID 134936243
2,2,4,9,9,11-hexamethyl-13,15-dithiadispiro[5.0.57.36]pentadeca-4,11-diene (PubChem CID 134936243) has the molecular formula C19H30S2 and a molecular weight of 322.58 g/mol. Its IUPAC name is 2,2,4,9,9,11-hexamethyl-13,15-dithiadispiro[5.0.57.36]pentadeca-4,11-diene.
| Compound Name | 2,2,4,9,9,11-hexamethyl-13,15-dithiadispiro[5.0.57.36]pentadeca-4,11-diene |
|---|---|
| PubChem CID | 134936243 |
| Molecular Formula | C19H30S2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2,2,4,9,9,11-hexamethyl-13,15-dithiadispiro[5.0.57.36]pentadeca-4,11-diene |
| SMILES | CC1=CC2(CC(C)(C)C1)SCSC21C=C(C)CC(C)(C)C1 |
| InChI | InChI=1S/C19H30S2/c1-14-7-16(3,4)11-18(9-14)19(21-13-20-18)10-15(2)8-17(5,6)12-19/h9-10H,7-8,11-13H2,1-6H3 |
| InChIKey | OGRBPBJTLDLSET-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|