C15H18N4 — CID 134986631
(5-tert-butyl-4-cyanoimino-2-ethyl-3-methylcyclohexa-2,5-dien-1-ylidene)cyanamide (PubChem CID 134986631) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is (5-tert-butyl-4-cyanoimino-2-ethyl-3-methylcyclohexa-2,5-dien-1-ylidene)cyanamide.
| Compound Name | (5-tert-butyl-4-cyanoimino-2-ethyl-3-methylcyclohexa-2,5-dien-1-ylidene)cyanamide |
|---|---|
| PubChem CID | 134986631 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (5-tert-butyl-4-cyanoimino-2-ethyl-3-methylcyclohexa-2,5-dien-1-ylidene)cyanamide |
| SMILES | CCC1=C(C)/C(=N\C#N)C(C(C)(C)C)=C/C1=N\C#N |
| InChI | InChI=1S/C15H18N4/c1-6-11-10(2)14(19-9-17)12(15(3,4)5)7-13(11)18-8-16/h7H,6H2,1-5H3/b18-13+,19-14+ |
| InChIKey | ZYJHXRQLONEJNW-JIBZRZDWSA-N |
| XLogP | 3.54 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|