C8H6N6 — CID 134986949
2,4-diaminopyrido[2,3-d]pyrimidine-7-carbonitrile (PubChem CID 134986949) has the molecular formula C8H6N6 and a molecular weight of 186.18 g/mol. Its IUPAC name is 2,4-diaminopyrido[2,3-d]pyrimidine-7-carbonitrile.
| Compound Name | 2,4-diaminopyrido[2,3-d]pyrimidine-7-carbonitrile |
|---|---|
| PubChem CID | 134986949 |
| Molecular Formula | C8H6N6 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 2,4-diaminopyrido[2,3-d]pyrimidine-7-carbonitrile |
| SMILES | N#Cc1ccc2c(N)nc(N)nc2n1 |
| InChI | InChI=1S/C8H6N6/c9-3-4-1-2-5-6(10)13-8(11)14-7(5)12-4/h1-2H,(H4,10,11,12,13,14) |
| InChIKey | LBEMYBCMCOJNSI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |