C14H14O3 — CID 134987054
2-ethyl-8,9-dihydro-7H-pyrano[2,3-g]chromen-4-one (PubChem CID 134987054) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-ethyl-8,9-dihydro-7H-pyrano[2,3-g]chromen-4-one.
| Compound Name | 2-ethyl-8,9-dihydro-7H-pyrano[2,3-g]chromen-4-one |
|---|---|
| PubChem CID | 134987054 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-ethyl-8,9-dihydro-7H-pyrano[2,3-g]chromen-4-one |
| SMILES | CCc1cc(=O)c2cc3c(cc2o1)CCCO3 |
| InChI | InChI=1S/C14H14O3/c1-2-10-7-12(15)11-8-13-9(4-3-5-16-13)6-14(11)17-10/h6-8H,2-5H2,1H3 |
| InChIKey | FHTJEQGRLWCHJJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |