C20H16N2O6 — CID 134910821
N-[2-nitro-4-(4-oxo-8,9-dihydro-7H-pyrano[2,3-g]chromen-2-yl)phenyl]acetamide (PubChem CID 134910821) has the molecular formula C20H16N2O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is N-[2-nitro-4-(4-oxo-8,9-dihydro-7H-pyrano[2,3-g]chromen-2-yl)phenyl]acetamide.
| Compound Name | N-[2-nitro-4-(4-oxo-8,9-dihydro-7H-pyrano[2,3-g]chromen-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 134910821 |
| Molecular Formula | C20H16N2O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-[2-nitro-4-(4-oxo-8,9-dihydro-7H-pyrano[2,3-g]chromen-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2cc(=O)c3cc4c(cc3o2)CCCO4)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16N2O6/c1-11(23)21-15-5-4-13(7-16(15)22(25)26)19-10-17(24)14-9-18-12(3-2-6-27-18)8-20(14)28-19/h4-5,7-10H,2-3,6H2,1H3,(H,21,23) |
| InChIKey | OIDDORAQTLZMIU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|