C14H28O3Si2 — CID 134988476
tert-butyl 4-oxo-2,3-bis(trimethylsilyl)but-3-enoate (PubChem CID 134988476) has the molecular formula C14H28O3Si2 and a molecular weight of 300.55 g/mol. Its IUPAC name is tert-butyl 4-oxo-2,3-bis(trimethylsilyl)but-3-enoate.
| Compound Name | tert-butyl 4-oxo-2,3-bis(trimethylsilyl)but-3-enoate |
|---|---|
| PubChem CID | 134988476 |
| Molecular Formula | C14H28O3Si2 |
| Molecular Weight | 300.55 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | tert-butyl 4-oxo-2,3-bis(trimethylsilyl)but-3-enoate |
| SMILES | CC(C)(C)OC(=O)C(C(=C=O)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H28O3Si2/c1-14(2,3)17-13(16)12(19(7,8)9)11(10-15)18(4,5)6/h12H,1-9H3 |
| InChIKey | IDRVGCYWICXVKH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|