C8H13NO4 — CID 174550466
2-amino-3-[(2-methylpropan-2-yl)oxy]-4-oxobut-3-enoic acid (PubChem CID 174550466) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is 2-amino-3-[(2-methylpropan-2-yl)oxy]-4-oxobut-3-enoic acid.
| Compound Name | 2-amino-3-[(2-methylpropan-2-yl)oxy]-4-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 174550466 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-amino-3-[(2-methylpropan-2-yl)oxy]-4-oxobut-3-enoic acid |
| SMILES | CC(C)(C)OC(=C=O)C(N)C(=O)O |
| InChI | InChI=1S/C8H13NO4/c1-8(2,3)13-5(4-10)6(9)7(11)12/h6H,9H2,1-3H3,(H,11,12) |
| InChIKey | RZMFMDMEYRENPJ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|