C10H16N2O3 — CID 87278787
tert-butyl 2-amino-3-oxo-3-(prop-2-ynylamino)propanoate (PubChem CID 87278787) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is tert-butyl 2-amino-3-oxo-3-(prop-2-ynylamino)propanoate.
| Compound Name | tert-butyl 2-amino-3-oxo-3-(prop-2-ynylamino)propanoate |
|---|---|
| PubChem CID | 87278787 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | tert-butyl 2-amino-3-oxo-3-(prop-2-ynylamino)propanoate |
| SMILES | C#CCNC(=O)C(N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H16N2O3/c1-5-6-12-8(13)7(11)9(14)15-10(2,3)4/h1,7H,6,11H2,2-4H3,(H,12,13) |
| InChIKey | QTWRQDFYINLLAE-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|