C9H17N3O3 — CID 174812403
2-amino-3-methyl-N-prop-2-ynylbutanamide;carbamic acid (PubChem CID 174812403) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-amino-3-methyl-N-prop-2-ynylbutanamide;carbamic acid.
| Compound Name | 2-amino-3-methyl-N-prop-2-ynylbutanamide;carbamic acid |
|---|---|
| PubChem CID | 174812403 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-amino-3-methyl-N-prop-2-ynylbutanamide;carbamic acid |
| SMILES | C#CCNC(=O)C(N)C(C)C.NC(=O)O |
| InChI | InChI=1S/C8H14N2O.CH3NO2/c1-4-5-10-8(11)7(9)6(2)3;2-1(3)4/h1,6-7H,5,9H2,2-3H3,(H,10,11);2H2,(H,3,4) |
| InChIKey | YFZAEWYJCVYQEK-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|