C7H8F2 — CID 134989112
3-(2,2-difluoroethenyl)cyclopentene (PubChem CID 134989112) has the molecular formula C7H8F2 and a molecular weight of 130.14 g/mol. Its IUPAC name is 3-(2,2-difluoroethenyl)cyclopentene.
| Compound Name | 3-(2,2-difluoroethenyl)cyclopentene |
|---|---|
| PubChem CID | 134989112 |
| Molecular Formula | C7H8F2 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 3-(2,2-difluoroethenyl)cyclopentene |
| SMILES | FC(F)=CC1C=CCC1 |
| InChI | InChI=1S/C7H8F2/c8-7(9)5-6-3-1-2-4-6/h1,3,5-6H,2,4H2 |
| InChIKey | YKJGYTQKDPZCJW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|