C9H14F2 — CID 57172031
4-ethenyl-1,7-difluorohept-2-ene (PubChem CID 57172031) has the molecular formula C9H14F2 and a molecular weight of 160.21 g/mol. Its IUPAC name is 4-ethenyl-1,7-difluorohept-2-ene.
| Compound Name | 4-ethenyl-1,7-difluorohept-2-ene |
|---|---|
| PubChem CID | 57172031 |
| Molecular Formula | C9H14F2 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 4-ethenyl-1,7-difluorohept-2-ene |
| SMILES | C=CC(C=CCF)CCCF |
| InChI | InChI=1S/C9H14F2/c1-2-9(5-3-7-10)6-4-8-11/h2-3,5,9H,1,4,6-8H2 |
| InChIKey | KCEIZFQKPHKQAW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|