C7H6F2 — CID 15129214
2,3-difluorobicyclo[2.2.1]hepta-2,5-diene (PubChem CID 15129214) has the molecular formula C7H6F2 and a molecular weight of 128.12 g/mol. Its IUPAC name is 2,3-difluorobicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2,3-difluorobicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 15129214 |
| Molecular Formula | C7H6F2 |
| Molecular Weight | 128.12 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 2,3-difluorobicyclo[2.2.1]hepta-2,5-diene |
| SMILES | FC1=C(F)C2C=CC1C2 |
| InChI | InChI=1S/C7H6F2/c8-6-4-1-2-5(3-4)7(6)9/h1-2,4-5H,3H2 |
| InChIKey | FBIUFNBIYZPHLC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.12 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|