C8H16O2 — CID 13499014
4,5-dimethylhex-5-ene-1,3-diol (PubChem CID 13499014) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is 4,5-dimethylhex-5-ene-1,3-diol.
| Compound Name | 4,5-dimethylhex-5-ene-1,3-diol |
|---|---|
| PubChem CID | 13499014 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 4,5-dimethylhex-5-ene-1,3-diol |
| SMILES | C=C(C)C(C)C(O)CCO |
| InChI | InChI=1S/C8H16O2/c1-6(2)7(3)8(10)4-5-9/h7-10H,1,4-5H2,2-3H3 |
| InChIKey | QHDCYCZJUGBNSW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|