C27H32NOP — CID 134991668
[(1R,2R,5S)-5-methyl-2-propan-2-yl-1-pyridin-2-ylcyclohexyl]oxy-diphenylphosphane (PubChem CID 134991668) has the molecular formula C27H32NOP and a molecular weight of 417.53 g/mol. Its IUPAC name is [(1R,2R,5S)-5-methyl-2-propan-2-yl-1-pyridin-2-ylcyclohexyl]oxy-diphenylphosphane.
| Compound Name | [(1R,2R,5S)-5-methyl-2-propan-2-yl-1-pyridin-2-ylcyclohexyl]oxy-diphenylphosphane |
|---|---|
| PubChem CID | 134991668 |
| Molecular Formula | C27H32NOP |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | [(1R,2R,5S)-5-methyl-2-propan-2-yl-1-pyridin-2-ylcyclohexyl]oxy-diphenylphosphane |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@]1(OP(c1ccccc1)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C27H32NOP/c1-21(2)25-18-17-22(3)20-27(25,26-16-10-11-19-28-26)29-30(23-12-6-4-7-13-23)24-14-8-5-9-15-24/h4-16,19,21-22,25H,17-18,20H2,1-3H3/t22-,25+,27+/m0/s1 |
| InChIKey | LDAAYCIFVXQJKT-GEWUYGHSSA-N |
| XLogP | 6.43 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|