C12H18O3 — CID 134991835
methyl (1S,2S,4S)-2-(1-hydroxypropyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 134991835) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is methyl (1S,2S,4S)-2-(1-hydroxypropyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | methyl (1S,2S,4S)-2-(1-hydroxypropyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 134991835 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | methyl (1S,2S,4S)-2-(1-hydroxypropyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCC(O)[C@]1(C(=O)OC)C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C12H18O3/c1-3-10(13)12(11(14)15-2)7-8-4-5-9(12)6-8/h4-5,8-10,13H,3,6-7H2,1-2H3/t8-,9+,10?,12-/m0/s1 |
| InChIKey | ZNCDPMGLEHOFKB-BLRASZIXSA-N |
| XLogP | 1.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|