C13H25NO2 — CID 134992590
(3Z)-2-butyl-3-hydroxyimino-1,5,5-trimethylcyclohexan-1-ol (PubChem CID 134992590) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is (3Z)-2-butyl-3-hydroxyimino-1,5,5-trimethylcyclohexan-1-ol.
| Compound Name | (3Z)-2-butyl-3-hydroxyimino-1,5,5-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 134992590 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | (3Z)-2-butyl-3-hydroxyimino-1,5,5-trimethylcyclohexan-1-ol |
| SMILES | CCCCC1/C(=N\O)CC(C)(C)CC1(C)O |
| InChI | InChI=1S/C13H25NO2/c1-5-6-7-10-11(14-16)8-12(2,3)9-13(10,4)15/h10,15-16H,5-9H2,1-4H3/b14-11- |
| InChIKey | OQZSRCHUCROAIR-KAMYIIQDSA-N |
| XLogP | 3.19 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|