C9H9F3OSe — CID 134993277
1,1,1-trifluoro-3-phenylselanylpropan-2-ol (PubChem CID 134993277) has the molecular formula C9H9F3OSe and a molecular weight of 269.12 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-phenylselanylpropan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-phenylselanylpropan-2-ol |
|---|---|
| PubChem CID | 134993277 |
| Molecular Formula | C9H9F3OSe |
| Molecular Weight | 269.12 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 1,1,1-trifluoro-3-phenylselanylpropan-2-ol |
| SMILES | OC(C[Se]c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C9H9F3OSe/c10-9(11,12)8(13)6-14-7-4-2-1-3-5-7/h1-5,8,13H,6H2 |
| InChIKey | SXFLWKVSYZYTDJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.12 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|