C16H26N2 — CID 134993990
(2R,3R)-2,3-bis[(1E)-2-methylpenta-1,4-dienyl]piperazine (PubChem CID 134993990) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(1E)-2-methylpenta-1,4-dienyl]piperazine.
| Compound Name | (2R,3R)-2,3-bis[(1E)-2-methylpenta-1,4-dienyl]piperazine |
|---|---|
| PubChem CID | 134993990 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (2R,3R)-2,3-bis[(1E)-2-methylpenta-1,4-dienyl]piperazine |
| SMILES | C=CC/C(C)=C/[C@H]1NCCN[C@@H]1/C=C(\C)CC=C |
| InChI | InChI=1S/C16H26N2/c1-5-7-13(3)11-15-16(18-10-9-17-15)12-14(4)8-6-2/h5-6,11-12,15-18H,1-2,7-10H2,3-4H3/b13-11+,14-12+/t15-,16-/m1/s1 |
| InChIKey | DHEJQPJEENWNAP-KWWKBFPYSA-N |
| XLogP | 2.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|