C11H18O4S — CID 134994393
diethyl (2S,3R)-4,4-dimethylthietane-2,3-dicarboxylate (PubChem CID 134994393) has the molecular formula C11H18O4S and a molecular weight of 246.33 g/mol. Its IUPAC name is diethyl (2S,3R)-4,4-dimethylthietane-2,3-dicarboxylate.
| Compound Name | diethyl (2S,3R)-4,4-dimethylthietane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 134994393 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | diethyl (2S,3R)-4,4-dimethylthietane-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1SC(C)(C)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C11H18O4S/c1-5-14-9(12)7-8(10(13)15-6-2)16-11(7,3)4/h7-8H,5-6H2,1-4H3/t7-,8-/m0/s1 |
| InChIKey | VASHQYPNUGKLPY-YUMQZZPRSA-N |
| XLogP | 1.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |