About 4-O-(2-ethylhexyl) 1-O-methyl 2-methylsulfanylbutanedioate
4-O-(2-ethylhexyl) 1-O-methyl 2-methylsulfanylbutanedioate (PubChem CID 89382852) has the molecular formula C14H26O4S
and a molecular weight of 290.42 g/mol. Its IUPAC name is 4-O-(2-ethylhexyl) 1-O-methyl 2-methylsulfanylbutanedioate.
Molecular Properties
| Compound Name | 4-O-(2-ethylhexyl) 1-O-methyl 2-methylsulfanylbutanedioate |
| PubChem CID | 89382852 |
| Molecular Formula | C14H26O4S |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 4-O-(2-ethylhexyl) 1-O-methyl 2-methylsulfanylbutanedioate |
| SMILES | CCCCC(CC)COC(=O)CC(SC)C(=O)OC |
| InChI | InChI=1S/C14H26O4S/c1-5-7-8-11(6-2)10-18-13(15)9-12(19-4)14(16)17-3/h11-12H,5-10H2,1-4H3 |
| InChIKey | OZOXZVRKLGRZAZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-O-(2-ethylhexyl) 1-O-methyl 2-methylsulfanylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(2-ethylhexyl) 1-O-methyl 2-methylsulfanylbutanedioate?
The IUPAC name of 4-O-(2-ethylhexyl) 1-O-methyl 2-methylsulfanylbutanedioate (CID 89382852) is 4-O-(2-ethylhexyl) 1-O-methyl 2-methylsulfanylbutanedioate.
What is the SMILES notation for 4-O-(2-ethylhexyl) 1-O-methyl 2-methylsulfanylbutanedioate?
The canonical SMILES for 4-O-(2-ethylhexyl) 1-O-methyl 2-methylsulfanylbutanedioate is CCCCC(CC)COC(=O)CC(SC)C(=O)OC.
What is the InChIKey of 4-O-(2-ethylhexyl) 1-O-methyl 2-methylsulfanylbutanedioate?
The InChIKey is OZOXZVRKLGRZAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4S/c1-5-7-8-11(6-2)10-18-13(15)9-12(19-4)14(16)17-3/h11-12H,5-10H2,1-4H3.
What are the key properties of 4-O-(2-ethylhexyl) 1-O-methyl 2-methylsulfanylbutanedioate?
4-O-(2-ethylhexyl) 1-O-methyl 2-methylsulfanylbutanedioate has a molecular weight of 290.42 g/mol, XLogP of 3.04, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(2-ethylhexyl) 1-O-methyl 2-methylsulfanylbutanedioate is sourced from PubChem (CID 89382852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).