C11H18O6S — CID 15441028
1-O-ethyl 4-O-methyl (2R,3S)-3-ethyl-2-methoxycarbonylsulfanylbutanedioate (PubChem CID 15441028) has the molecular formula C11H18O6S and a molecular weight of 278.33 g/mol. Its IUPAC name is 1-O-ethyl 4-O-methyl (2R,3S)-3-ethyl-2-methoxycarbonylsulfanylbutanedioate.
| Compound Name | 1-O-ethyl 4-O-methyl (2R,3S)-3-ethyl-2-methoxycarbonylsulfanylbutanedioate |
|---|---|
| PubChem CID | 15441028 |
| Molecular Formula | C11H18O6S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 1-O-ethyl 4-O-methyl (2R,3S)-3-ethyl-2-methoxycarbonylsulfanylbutanedioate |
| SMILES | CCOC(=O)[C@H](SC(=O)OC)[C@@H](CC)C(=O)OC |
| InChI | InChI=1S/C11H18O6S/c1-5-7(9(12)15-3)8(10(13)17-6-2)18-11(14)16-4/h7-8H,5-6H2,1-4H3/t7-,8-/m1/s1 |
| InChIKey | WATWOIPDWPGKMS-HTQZYQBOSA-N |
| XLogP | 1.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|