About bicyclo[11.4.0]heptadeca-3,10-diyne
bicyclo[11.4.0]heptadeca-3,10-diyne (PubChem CID 134994752) has the molecular formula C17H24
and a molecular weight of 228.38 g/mol. Its IUPAC name is bicyclo[11.4.0]heptadeca-3,10-diyne.
Molecular Properties
| Compound Name | bicyclo[11.4.0]heptadeca-3,10-diyne |
| PubChem CID | 134994752 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | bicyclo[11.4.0]heptadeca-3,10-diyne |
| SMILES | C1#CCC2CCCCC2CC#CCCCCC1 |
| InChI | InChI=1S/C17H24/c1-2-4-6-8-12-16-14-10-11-15-17(16)13-9-7-5-3-1/h16-17H,1-5,10-15H2 |
| InChIKey | UDHSFKCLZDHPDV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[11.4.0]heptadeca-3,10-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[11.4.0]heptadeca-3,10-diyne?
The IUPAC name of bicyclo[11.4.0]heptadeca-3,10-diyne (CID 134994752) is bicyclo[11.4.0]heptadeca-3,10-diyne.
What is the SMILES notation for bicyclo[11.4.0]heptadeca-3,10-diyne?
The canonical SMILES for bicyclo[11.4.0]heptadeca-3,10-diyne is C1#CCC2CCCCC2CC#CCCCCC1.
What is the InChIKey of bicyclo[11.4.0]heptadeca-3,10-diyne?
The InChIKey is UDHSFKCLZDHPDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24/c1-2-4-6-8-12-16-14-10-11-15-17(16)13-9-7-5-3-1/h16-17H,1-5,10-15H2.
What are the key properties of bicyclo[11.4.0]heptadeca-3,10-diyne?
bicyclo[11.4.0]heptadeca-3,10-diyne has a molecular weight of 228.38 g/mol, XLogP of 4.54, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[11.4.0]heptadeca-3,10-diyne is sourced from PubChem (CID 134994752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).