C20H28 — CID 134976309
tricyclo[14.3.1.06,11]icosa-3,13-diyne (PubChem CID 134976309) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is tricyclo[14.3.1.06,11]icosa-3,13-diyne.
| Compound Name | tricyclo[14.3.1.06,11]icosa-3,13-diyne |
|---|---|
| PubChem CID | 134976309 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | tricyclo[14.3.1.06,11]icosa-3,13-diyne |
| SMILES | C1#CCC2CCCCC2CC#CCC2CCCC(C1)C2 |
| InChI | InChI=1S/C20H28/c1-3-12-19-14-5-6-15-20(19)13-4-2-9-18-11-7-10-17(8-1)16-18/h17-20H,5-16H2 |
| InChIKey | GWAIBIVWHQJKEQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|