C14H24 — CID 134994883
5-pent-1-en-3-ylnona-2,3-diene (PubChem CID 134994883) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 5-pent-1-en-3-ylnona-2,3-diene.
| Compound Name | 5-pent-1-en-3-ylnona-2,3-diene |
|---|---|
| PubChem CID | 134994883 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 5-pent-1-en-3-ylnona-2,3-diene |
| SMILES | C=CC(CC)C(C=C=CC)CCCC |
| InChI | InChI=1S/C14H24/c1-5-9-11-14(12-10-6-2)13(7-3)8-4/h5,7,11,13-14H,3,6,8,10,12H2,1-2,4H3 |
| InChIKey | DCZQCQVMZHWRCW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|