C14H18 — CID 134994893
5,6,11,12-tetradehydro-1,2,3,4,4a,7,8,9,10,12a-decahydrobenzo[10]annulene (PubChem CID 134994893) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 5,6,11,12-tetradehydro-1,2,3,4,4a,7,8,9,10,12a-decahydrobenzo[10]annulene.
| Compound Name | 5,6,11,12-tetradehydro-1,2,3,4,4a,7,8,9,10,12a-decahydrobenzo[10]annulene |
|---|---|
| PubChem CID | 134994893 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 5,6,11,12-tetradehydro-1,2,3,4,4a,7,8,9,10,12a-decahydrobenzo[10]annulene |
| SMILES | C1#CC2CCCCC2C#CCCCC1 |
| InChI | InChI=1S/C14H18/c1-2-4-6-10-14-12-8-7-11-13(14)9-5-3-1/h13-14H,1-4,7-8,11-12H2 |
| InChIKey | YOCMBQMIPZNPJM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|