C8H13N — CID 134995068
(Z)-N,N-diethylbut-1-en-3-yn-1-amine (PubChem CID 134995068) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is (Z)-N,N-diethylbut-1-en-3-yn-1-amine.
| Compound Name | (Z)-N,N-diethylbut-1-en-3-yn-1-amine |
|---|---|
| PubChem CID | 134995068 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (Z)-N,N-diethylbut-1-en-3-yn-1-amine |
| SMILES | C#C/C=C\N(CC)CC |
| InChI | InChI=1S/C8H13N/c1-4-7-8-9(5-2)6-3/h1,7-8H,5-6H2,2-3H3/b8-7- |
| InChIKey | UDQMVAYZZYCMOT-FPLPWBNLSA-N |
| XLogP | 1.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|