C15H26 — CID 134995226
(5S,9R)-2,5,9,10-tetramethylundec-2-en-7-yne (PubChem CID 134995226) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is (5S,9R)-2,5,9,10-tetramethylundec-2-en-7-yne.
| Compound Name | (5S,9R)-2,5,9,10-tetramethylundec-2-en-7-yne |
|---|---|
| PubChem CID | 134995226 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (5S,9R)-2,5,9,10-tetramethylundec-2-en-7-yne |
| SMILES | CC(C)=CC[C@H](C)CC#C[C@H](C)C(C)C |
| InChI | InChI=1S/C15H26/c1-12(2)10-11-14(5)8-7-9-15(6)13(3)4/h10,13-15H,8,11H2,1-6H3/t14-,15+/m1/s1 |
| InChIKey | DHSHGBUUHVBRGR-CABCVRRESA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|