C13H20O2 — CID 134995276
3-(3,4,4-trimethylpenta-1,2-dienyl)oxan-2-one (PubChem CID 134995276) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 3-(3,4,4-trimethylpenta-1,2-dienyl)oxan-2-one.
| Compound Name | 3-(3,4,4-trimethylpenta-1,2-dienyl)oxan-2-one |
|---|---|
| PubChem CID | 134995276 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 3-(3,4,4-trimethylpenta-1,2-dienyl)oxan-2-one |
| SMILES | CC(=C=CC1CCCOC1=O)C(C)(C)C |
| InChI | InChI=1S/C13H20O2/c1-10(13(2,3)4)7-8-11-6-5-9-15-12(11)14/h8,11H,5-6,9H2,1-4H3 |
| InChIKey | JUJISINGPJYNDJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |