C11H21NO2 — CID 134995514
(1S)-2-(diethylamino)-1-[(2R,3R)-2-ethenyloxetan-3-yl]ethanol (PubChem CID 134995514) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (1S)-2-(diethylamino)-1-[(2R,3R)-2-ethenyloxetan-3-yl]ethanol.
| Compound Name | (1S)-2-(diethylamino)-1-[(2R,3R)-2-ethenyloxetan-3-yl]ethanol |
|---|---|
| PubChem CID | 134995514 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (1S)-2-(diethylamino)-1-[(2R,3R)-2-ethenyloxetan-3-yl]ethanol |
| SMILES | C=C[C@H]1OC[C@@H]1[C@H](O)CN(CC)CC |
| InChI | InChI=1S/C11H21NO2/c1-4-11-9(8-14-11)10(13)7-12(5-2)6-3/h4,9-11,13H,1,5-8H2,2-3H3/t9-,10-,11-/m1/s1 |
| InChIKey | PICGVSJSIQPOOZ-GMTAPVOTSA-N |
| XLogP | 0.89 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|